C21H28N2O3S — CID 112504783
N-[2-(azepan-1-yl)-2-thiophen-2-ylethyl]-3,5-dimethoxybenzamide (PubChem CID 112504783) has the molecular formula C21H28N2O3S and a molecular weight of 388.53 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)-2-thiophen-2-ylethyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[2-(azepan-1-yl)-2-thiophen-2-ylethyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 112504783 |
| Molecular Formula | C21H28N2O3S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N-[2-(azepan-1-yl)-2-thiophen-2-ylethyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NCC(c2cccs2)N2CCCCCC2)c1 |
| InChI | InChI=1S/C21H28N2O3S/c1-25-17-12-16(13-18(14-17)26-2)21(24)22-15-19(20-8-7-11-27-20)23-9-5-3-4-6-10-23/h7-8,11-14,19H,3-6,9-10,15H2,1-2H3,(H,22,24) |
| InChIKey | MDOBZQFRVJSMPG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |