C17H18F2N2OS — CID 34979612
3,5-difluoro-N-[(2S)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]benzamide (PubChem CID 34979612) has the molecular formula C17H18F2N2OS and a molecular weight of 336.41 g/mol. Its IUPAC name is 3,5-difluoro-N-[(2S)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]benzamide.
| Compound Name | 3,5-difluoro-N-[(2S)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]benzamide |
|---|---|
| PubChem CID | 34979612 |
| Molecular Formula | C17H18F2N2OS |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 3,5-difluoro-N-[(2S)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]benzamide |
| SMILES | O=C(NC[C@@H](c1cccs1)N1CCCC1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C17H18F2N2OS/c18-13-8-12(9-14(19)10-13)17(22)20-11-15(16-4-3-7-23-16)21-5-1-2-6-21/h3-4,7-10,15H,1-2,5-6,11H2,(H,20,22)/t15-/m0/s1 |
| InChIKey | OTCSZUBRHRBHBS-HNNXBMFYSA-N |
| XLogP | 3.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |