C22H28N2O3 — CID 112506440
3,5-dimethoxy-N-[2-(2-methylphenyl)-2-pyrrolidin-1-ylethyl]benzamide (PubChem CID 112506440) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[2-(2-methylphenyl)-2-pyrrolidin-1-ylethyl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[2-(2-methylphenyl)-2-pyrrolidin-1-ylethyl]benzamide |
|---|---|
| PubChem CID | 112506440 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 3,5-dimethoxy-N-[2-(2-methylphenyl)-2-pyrrolidin-1-ylethyl]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)NCC(c2ccccc2C)N2CCCC2)c1 |
| InChI | InChI=1S/C22H28N2O3/c1-16-8-4-5-9-20(16)21(24-10-6-7-11-24)15-23-22(25)17-12-18(26-2)14-19(13-17)27-3/h4-5,8-9,12-14,21H,6-7,10-11,15H2,1-3H3,(H,23,25) |
| InChIKey | KOICLTVYXIXXEJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |