C27H37N3O4S — CID 43006589
N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-2-methyl-5-piperidin-1-ylsulfonylbenzamide (PubChem CID 43006589) has the molecular formula C27H37N3O4S and a molecular weight of 499.68 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-2-methyl-5-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-2-methyl-5-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 43006589 |
| Molecular Formula | C27H37N3O4S |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-2-methyl-5-piperidin-1-ylsulfonylbenzamide |
| SMILES | COc1ccc(C(CNC(=O)c2cc(S(=O)(=O)N3CCCCC3)ccc2C)N2CCCCC2)cc1 |
| InChI | InChI=1S/C27H37N3O4S/c1-21-9-14-24(35(32,33)30-17-7-4-8-18-30)19-25(21)27(31)28-20-26(29-15-5-3-6-16-29)22-10-12-23(34-2)13-11-22/h9-14,19,26H,3-8,15-18,20H2,1-2H3,(H,28,31) |
| InChIKey | HBBUYCZQQSOYAU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |