C22H31Cl2N3O2 — CID 120639768
5-amino-N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-2-methylbenzamide;dihydrochloride (PubChem CID 120639768) has the molecular formula C22H31Cl2N3O2 and a molecular weight of 440.42 g/mol. Its IUPAC name is 5-amino-N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-2-methylbenzamide;dihydrochloride.
| Compound Name | 5-amino-N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-2-methylbenzamide;dihydrochloride |
|---|---|
| PubChem CID | 120639768 |
| Molecular Formula | C22H31Cl2N3O2 |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 5-amino-N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-2-methylbenzamide;dihydrochloride |
| SMILES | COc1ccc(C(CNC(=O)c2cc(N)ccc2C)N2CCCCC2)cc1.Cl.Cl |
| InChI | InChI=1S/C22H29N3O2.2ClH/c1-16-6-9-18(23)14-20(16)22(26)24-15-21(25-12-4-3-5-13-25)17-7-10-19(27-2)11-8-17;;/h6-11,14,21H,3-5,12-13,15,23H2,1-2H3,(H,24,26);2*1H |
| InChIKey | NSPKBYNAJDKHGX-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|