C21H25ClN2O5S2 — CID 28591075
N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-2-methoxy-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 28591075) has the molecular formula C21H25ClN2O5S2 and a molecular weight of 485.03 g/mol. Its IUPAC name is N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-2-methoxy-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-2-methoxy-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 28591075 |
| Molecular Formula | C21H25ClN2O5S2 |
| Molecular Weight | 485.03 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-2-methoxy-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCOCC2)cc1C(=O)NCCSCc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H25ClN2O5S2/c1-28-20-6-5-18(31(26,27)24-8-10-29-11-9-24)14-19(20)21(25)23-7-12-30-15-16-3-2-4-17(22)13-16/h2-6,13-14H,7-12,15H2,1H3,(H,23,25) |
| InChIKey | LEQHZBRXSWPDDV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.03 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|