C23H30N2O3S2 — CID 28590329
5-(azepan-1-ylsulfonyl)-N-(2-benzylsulfanylethyl)-2-methylbenzamide (PubChem CID 28590329) has the molecular formula C23H30N2O3S2 and a molecular weight of 446.64 g/mol. Its IUPAC name is 5-(azepan-1-ylsulfonyl)-N-(2-benzylsulfanylethyl)-2-methylbenzamide.
| Compound Name | 5-(azepan-1-ylsulfonyl)-N-(2-benzylsulfanylethyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 28590329 |
| Molecular Formula | C23H30N2O3S2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 5-(azepan-1-ylsulfonyl)-N-(2-benzylsulfanylethyl)-2-methylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCCC2)cc1C(=O)NCCSCc1ccccc1 |
| InChI | InChI=1S/C23H30N2O3S2/c1-19-11-12-21(30(27,28)25-14-7-2-3-8-15-25)17-22(19)23(26)24-13-16-29-18-20-9-5-4-6-10-20/h4-6,9-12,17H,2-3,7-8,13-16,18H2,1H3,(H,24,26) |
| InChIKey | ZOOYNSCYHOCGGV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|