C24H33N3O3S — CID 27831858
N-[3-[benzyl(methyl)amino]propyl]-2-methyl-5-piperidin-1-ylsulfonylbenzamide (PubChem CID 27831858) has the molecular formula C24H33N3O3S and a molecular weight of 443.61 g/mol. Its IUPAC name is N-[3-[benzyl(methyl)amino]propyl]-2-methyl-5-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[3-[benzyl(methyl)amino]propyl]-2-methyl-5-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 27831858 |
| Molecular Formula | C24H33N3O3S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | N-[3-[benzyl(methyl)amino]propyl]-2-methyl-5-piperidin-1-ylsulfonylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC2)cc1C(=O)NCCCN(C)Cc1ccccc1 |
| InChI | InChI=1S/C24H33N3O3S/c1-20-12-13-22(31(29,30)27-16-7-4-8-17-27)18-23(20)24(28)25-14-9-15-26(2)19-21-10-5-3-6-11-21/h3,5-6,10-13,18H,4,7-9,14-17,19H2,1-2H3,(H,25,28) |
| InChIKey | UGUYMUCFAQJLQS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|