C23H30N2O4S2 — CID 28590998
2-methoxy-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]-5-piperidin-1-ylsulfonylbenzamide (PubChem CID 28590998) has the molecular formula C23H30N2O4S2 and a molecular weight of 462.64 g/mol. Its IUPAC name is 2-methoxy-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]-5-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 2-methoxy-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]-5-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 28590998 |
| Molecular Formula | C23H30N2O4S2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 2-methoxy-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]-5-piperidin-1-ylsulfonylbenzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCC2)cc1C(=O)NCCSCc1ccc(C)cc1 |
| InChI | InChI=1S/C23H30N2O4S2/c1-18-6-8-19(9-7-18)17-30-15-12-24-23(26)21-16-20(10-11-22(21)29-2)31(27,28)25-13-4-3-5-14-25/h6-11,16H,3-5,12-15,17H2,1-2H3,(H,24,26) |
| InChIKey | RLJAAZHYHGKASC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|