C20H32N2O6S — CID 55407925
5-(azepan-1-ylsulfonyl)-2-methoxy-N-[3-(2-methoxyethoxy)propyl]benzamide (PubChem CID 55407925) has the molecular formula C20H32N2O6S and a molecular weight of 428.55 g/mol. Its IUPAC name is 5-(azepan-1-ylsulfonyl)-2-methoxy-N-[3-(2-methoxyethoxy)propyl]benzamide.
| Compound Name | 5-(azepan-1-ylsulfonyl)-2-methoxy-N-[3-(2-methoxyethoxy)propyl]benzamide |
|---|---|
| PubChem CID | 55407925 |
| Molecular Formula | C20H32N2O6S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 5-(azepan-1-ylsulfonyl)-2-methoxy-N-[3-(2-methoxyethoxy)propyl]benzamide |
| SMILES | COCCOCCCNC(=O)c1cc(S(=O)(=O)N2CCCCCC2)ccc1OC |
| InChI | InChI=1S/C20H32N2O6S/c1-26-14-15-28-13-7-10-21-20(23)18-16-17(8-9-19(18)27-2)29(24,25)22-11-5-3-4-6-12-22/h8-9,16H,3-7,10-15H2,1-2H3,(H,21,23) |
| InChIKey | PHCFABOPXCYQLX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|