C20H26N2O4S2 — CID 3184652
N-[2-(3-methylphenyl)ethyl]-4-piperidin-1-ylsulfonylbenzenesulfonamide (PubChem CID 3184652) has the molecular formula C20H26N2O4S2 and a molecular weight of 422.57 g/mol. Its IUPAC name is N-[2-(3-methylphenyl)ethyl]-4-piperidin-1-ylsulfonylbenzenesulfonamide.
| Compound Name | N-[2-(3-methylphenyl)ethyl]-4-piperidin-1-ylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 3184652 |
| Molecular Formula | C20H26N2O4S2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | N-[2-(3-methylphenyl)ethyl]-4-piperidin-1-ylsulfonylbenzenesulfonamide |
| SMILES | Cc1cccc(CCNS(=O)(=O)c2ccc(S(=O)(=O)N3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C20H26N2O4S2/c1-17-6-5-7-18(16-17)12-13-21-27(23,24)19-8-10-20(11-9-19)28(25,26)22-14-3-2-4-15-22/h5-11,16,21H,2-4,12-15H2,1H3 |
| InChIKey | LKTCVZNMBWKZQK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |