C19H25N3O6S3 — CID 30126367
4-(methanesulfonamido)-N-[2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl]benzenesulfonamide (PubChem CID 30126367) has the molecular formula C19H25N3O6S3 and a molecular weight of 487.63 g/mol. Its IUPAC name is 4-(methanesulfonamido)-N-[2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl]benzenesulfonamide.
| Compound Name | 4-(methanesulfonamido)-N-[2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 30126367 |
| Molecular Formula | C19H25N3O6S3 |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | 4-(methanesulfonamido)-N-[2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl]benzenesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(S(=O)(=O)NCCc2ccc(S(=O)(=O)N3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C19H25N3O6S3/c1-29(23,24)21-17-6-10-18(11-7-17)30(25,26)20-13-12-16-4-8-19(9-5-16)31(27,28)22-14-2-3-15-22/h4-11,20-21H,2-3,12-15H2,1H3 |
| InChIKey | ZXOBIVMQHVAUPW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |