C20H25ClN2O5S2 — CID 30126082
3-chloro-4-methoxy-N-[2-(4-piperidin-1-ylsulfonylphenyl)ethyl]benzenesulfonamide (PubChem CID 30126082) has the molecular formula C20H25ClN2O5S2 and a molecular weight of 473.02 g/mol. Its IUPAC name is 3-chloro-4-methoxy-N-[2-(4-piperidin-1-ylsulfonylphenyl)ethyl]benzenesulfonamide.
| Compound Name | 3-chloro-4-methoxy-N-[2-(4-piperidin-1-ylsulfonylphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 30126082 |
| Molecular Formula | C20H25ClN2O5S2 |
| Molecular Weight | 473.02 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | 3-chloro-4-methoxy-N-[2-(4-piperidin-1-ylsulfonylphenyl)ethyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCc2ccc(S(=O)(=O)N3CCCCC3)cc2)cc1Cl |
| InChI | InChI=1S/C20H25ClN2O5S2/c1-28-20-10-9-18(15-19(20)21)29(24,25)22-12-11-16-5-7-17(8-6-16)30(26,27)23-13-3-2-4-14-23/h5-10,15,22H,2-4,11-14H2,1H3 |
| InChIKey | FYHRCAQEDPNAFI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.02 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |