C23H32N2O5S2 — CID 30126330
2-methoxy-N-[2-(4-piperidin-1-ylsulfonylphenyl)ethyl]-5-propan-2-ylbenzenesulfonamide (PubChem CID 30126330) has the molecular formula C23H32N2O5S2 and a molecular weight of 480.65 g/mol. Its IUPAC name is 2-methoxy-N-[2-(4-piperidin-1-ylsulfonylphenyl)ethyl]-5-propan-2-ylbenzenesulfonamide.
| Compound Name | 2-methoxy-N-[2-(4-piperidin-1-ylsulfonylphenyl)ethyl]-5-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 30126330 |
| Molecular Formula | C23H32N2O5S2 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 2-methoxy-N-[2-(4-piperidin-1-ylsulfonylphenyl)ethyl]-5-propan-2-ylbenzenesulfonamide |
| SMILES | COc1ccc(C(C)C)cc1S(=O)(=O)NCCc1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C23H32N2O5S2/c1-18(2)20-9-12-22(30-3)23(17-20)31(26,27)24-14-13-19-7-10-21(11-8-19)32(28,29)25-15-5-4-6-16-25/h7-12,17-18,24H,4-6,13-16H2,1-3H3 |
| InChIKey | TZTBDBFPBSRGRE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |