C22H29N3O7S2 — CID 30126350
N-ethyl-4-methoxy-3-[2-(4-morpholin-4-ylsulfonylphenyl)ethylsulfamoyl]benzamide (PubChem CID 30126350) has the molecular formula C22H29N3O7S2 and a molecular weight of 511.62 g/mol. Its IUPAC name is N-ethyl-4-methoxy-3-[2-(4-morpholin-4-ylsulfonylphenyl)ethylsulfamoyl]benzamide.
| Compound Name | N-ethyl-4-methoxy-3-[2-(4-morpholin-4-ylsulfonylphenyl)ethylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 30126350 |
| Molecular Formula | C22H29N3O7S2 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | N-ethyl-4-methoxy-3-[2-(4-morpholin-4-ylsulfonylphenyl)ethylsulfamoyl]benzamide |
| SMILES | CCNC(=O)c1ccc(OC)c(S(=O)(=O)NCCc2ccc(S(=O)(=O)N3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C22H29N3O7S2/c1-3-23-22(26)18-6-9-20(31-2)21(16-18)33(27,28)24-11-10-17-4-7-19(8-5-17)34(29,30)25-12-14-32-15-13-25/h4-9,16,24H,3,10-15H2,1-2H3,(H,23,26) |
| InChIKey | WKIKJJRIAVUAHU-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |