C17H26N2O6S — CID 18892317
N-(3-ethoxypropyl)-4-methoxy-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 18892317) has the molecular formula C17H26N2O6S and a molecular weight of 386.47 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-4-methoxy-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-(3-ethoxypropyl)-4-methoxy-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 18892317 |
| Molecular Formula | C17H26N2O6S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | N-(3-ethoxypropyl)-4-methoxy-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | CCOCCCNC(=O)c1ccc(OC)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C17H26N2O6S/c1-3-24-10-4-7-18-17(20)14-5-6-15(23-2)16(13-14)26(21,22)19-8-11-25-12-9-19/h5-6,13H,3-4,7-12H2,1-2H3,(H,18,20) |
| InChIKey | DCEPSRTXRUDJAI-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|