C21H34N4O4S — CID 55660270
N-[3-(4-ethylpiperazin-1-yl)propyl]-4-methoxy-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 55660270) has the molecular formula C21H34N4O4S and a molecular weight of 438.59 g/mol. Its IUPAC name is N-[3-(4-ethylpiperazin-1-yl)propyl]-4-methoxy-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-[3-(4-ethylpiperazin-1-yl)propyl]-4-methoxy-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55660270 |
| Molecular Formula | C21H34N4O4S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | N-[3-(4-ethylpiperazin-1-yl)propyl]-4-methoxy-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CCN1CCN(CCCNC(=O)c2ccc(OC)c(S(=O)(=O)N3CCCC3)c2)CC1 |
| InChI | InChI=1S/C21H34N4O4S/c1-3-23-13-15-24(16-14-23)10-6-9-22-21(26)18-7-8-19(29-2)20(17-18)30(27,28)25-11-4-5-12-25/h7-8,17H,3-6,9-16H2,1-2H3,(H,22,26) |
| InChIKey | WBQRPNSDGCXYCT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|