C21H33ClN4O3S — CID 55660146
4-chloro-N-[3-(4-ethylpiperazin-1-yl)propyl]-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 55660146) has the molecular formula C21H33ClN4O3S and a molecular weight of 457.04 g/mol. Its IUPAC name is 4-chloro-N-[3-(4-ethylpiperazin-1-yl)propyl]-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 4-chloro-N-[3-(4-ethylpiperazin-1-yl)propyl]-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55660146 |
| Molecular Formula | C21H33ClN4O3S |
| Molecular Weight | 457.04 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 4-chloro-N-[3-(4-ethylpiperazin-1-yl)propyl]-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | CCN1CCN(CCCNC(=O)c2ccc(Cl)c(S(=O)(=O)N3CCCCC3)c2)CC1 |
| InChI | InChI=1S/C21H33ClN4O3S/c1-2-24-13-15-25(16-14-24)10-6-9-23-21(27)18-7-8-19(22)20(17-18)30(28,29)26-11-4-3-5-12-26/h7-8,17H,2-6,9-16H2,1H3,(H,23,27) |
| InChIKey | FQJBLXVCMWCWOC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.04 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|