C17H26ClN3O3S — CID 99969242
4-chloro-3-(4-methylpiperazin-1-yl)sulfonyl-N-pentylbenzamide (PubChem CID 99969242) has the molecular formula C17H26ClN3O3S and a molecular weight of 387.93 g/mol. Its IUPAC name is 4-chloro-3-(4-methylpiperazin-1-yl)sulfonyl-N-pentylbenzamide.
| Compound Name | 4-chloro-3-(4-methylpiperazin-1-yl)sulfonyl-N-pentylbenzamide |
|---|---|
| PubChem CID | 99969242 |
| Molecular Formula | C17H26ClN3O3S |
| Molecular Weight | 387.93 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 4-chloro-3-(4-methylpiperazin-1-yl)sulfonyl-N-pentylbenzamide |
| SMILES | CCCCCNC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C17H26ClN3O3S/c1-3-4-5-8-19-17(22)14-6-7-15(18)16(13-14)25(23,24)21-11-9-20(2)10-12-21/h6-7,13H,3-5,8-12H2,1-2H3,(H,19,22) |
| InChIKey | HKDBCWQGHQAZEY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.93 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|