C18H27ClN4O4S — CID 99969256
4-chloro-3-(4-methylpiperazin-1-yl)sulfonyl-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 99969256) has the molecular formula C18H27ClN4O4S and a molecular weight of 430.96 g/mol. Its IUPAC name is 4-chloro-3-(4-methylpiperazin-1-yl)sulfonyl-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | 4-chloro-3-(4-methylpiperazin-1-yl)sulfonyl-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 99969256 |
| Molecular Formula | C18H27ClN4O4S |
| Molecular Weight | 430.96 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 4-chloro-3-(4-methylpiperazin-1-yl)sulfonyl-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | CN1CCN(S(=O)(=O)c2cc(C(=O)NCCN3CCOCC3)ccc2Cl)CC1 |
| InChI | InChI=1S/C18H27ClN4O4S/c1-21-6-8-23(9-7-21)28(25,26)17-14-15(2-3-16(17)19)18(24)20-4-5-22-10-12-27-13-11-22/h2-3,14H,4-13H2,1H3,(H,20,24) |
| InChIKey | RVKAKNCISBRFER-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.96 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |