C20H24ClN3O5S — CID 35161549
4-chloro-3-[(4-methoxyphenyl)sulfamoyl]-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 35161549) has the molecular formula C20H24ClN3O5S and a molecular weight of 453.95 g/mol. Its IUPAC name is 4-chloro-3-[(4-methoxyphenyl)sulfamoyl]-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | 4-chloro-3-[(4-methoxyphenyl)sulfamoyl]-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 35161549 |
| Molecular Formula | C20H24ClN3O5S |
| Molecular Weight | 453.95 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 4-chloro-3-[(4-methoxyphenyl)sulfamoyl]-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(C(=O)NCCN3CCOCC3)ccc2Cl)cc1 |
| InChI | InChI=1S/C20H24ClN3O5S/c1-28-17-5-3-16(4-6-17)23-30(26,27)19-14-15(2-7-18(19)21)20(25)22-8-9-24-10-12-29-13-11-24/h2-7,14,23H,8-13H2,1H3,(H,22,25) |
| InChIKey | VVNPIVUXQXDRGF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.95 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |