C22H21ClN2O6S — CID 24537222
4-chloro-N-(3,5-dimethoxyphenyl)-3-[(4-methoxyphenyl)sulfamoyl]benzamide (PubChem CID 24537222) has the molecular formula C22H21ClN2O6S and a molecular weight of 476.94 g/mol. Its IUPAC name is 4-chloro-N-(3,5-dimethoxyphenyl)-3-[(4-methoxyphenyl)sulfamoyl]benzamide.
| Compound Name | 4-chloro-N-(3,5-dimethoxyphenyl)-3-[(4-methoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 24537222 |
| Molecular Formula | C22H21ClN2O6S |
| Molecular Weight | 476.94 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | 4-chloro-N-(3,5-dimethoxyphenyl)-3-[(4-methoxyphenyl)sulfamoyl]benzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(C(=O)Nc3cc(OC)cc(OC)c3)ccc2Cl)cc1 |
| InChI | InChI=1S/C22H21ClN2O6S/c1-29-17-7-5-15(6-8-17)25-32(27,28)21-10-14(4-9-20(21)23)22(26)24-16-11-18(30-2)13-19(12-16)31-3/h4-13,25H,1-3H3,(H,24,26) |
| InChIKey | KCSDGYKCXDNBMT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.94 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |