C20H17Cl2N3O4S — CID 24563955
N-(4-amino-3,5-dichlorophenyl)-4-[(4-methoxyphenyl)sulfamoyl]benzamide (PubChem CID 24563955) has the molecular formula C20H17Cl2N3O4S and a molecular weight of 466.35 g/mol. Its IUPAC name is N-(4-amino-3,5-dichlorophenyl)-4-[(4-methoxyphenyl)sulfamoyl]benzamide.
| Compound Name | N-(4-amino-3,5-dichlorophenyl)-4-[(4-methoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 24563955 |
| Molecular Formula | C20H17Cl2N3O4S |
| Molecular Weight | 466.35 g/mol |
| Exact Mass | 465.03 |
| IUPAC Name | N-(4-amino-3,5-dichlorophenyl)-4-[(4-methoxyphenyl)sulfamoyl]benzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(C(=O)Nc3cc(Cl)c(N)c(Cl)c3)cc2)cc1 |
| InChI | InChI=1S/C20H17Cl2N3O4S/c1-29-15-6-4-13(5-7-15)25-30(27,28)16-8-2-12(3-9-16)20(26)24-14-10-17(21)19(23)18(22)11-14/h2-11,25H,23H2,1H3,(H,24,26) |
| InChIKey | SVVBSOIIJUCQCR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.35 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|