C14H13Cl2N3O3S — CID 8538672
N-[4-[(4-amino-3,5-dichlorophenyl)sulfamoyl]phenyl]acetamide (PubChem CID 8538672) has the molecular formula C14H13Cl2N3O3S and a molecular weight of 374.25 g/mol. Its IUPAC name is N-[4-[(4-amino-3,5-dichlorophenyl)sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[(4-amino-3,5-dichlorophenyl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 8538672 |
| Molecular Formula | C14H13Cl2N3O3S |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | N-[4-[(4-amino-3,5-dichlorophenyl)sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2cc(Cl)c(N)c(Cl)c2)cc1 |
| InChI | InChI=1S/C14H13Cl2N3O3S/c1-8(20)18-9-2-4-11(5-3-9)23(21,22)19-10-6-12(15)14(17)13(16)7-10/h2-7,19H,17H2,1H3,(H,18,20) |
| InChIKey | UIOXHYVNIHVJPJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|