C17H18ClN3O4S — CID 110314496
4-[(4-acetamidophenyl)sulfonylamino]-2-chloro-N,N-dimethylbenzamide (PubChem CID 110314496) has the molecular formula C17H18ClN3O4S and a molecular weight of 395.87 g/mol. Its IUPAC name is 4-[(4-acetamidophenyl)sulfonylamino]-2-chloro-N,N-dimethylbenzamide.
| Compound Name | 4-[(4-acetamidophenyl)sulfonylamino]-2-chloro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 110314496 |
| Molecular Formula | C17H18ClN3O4S |
| Molecular Weight | 395.87 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 4-[(4-acetamidophenyl)sulfonylamino]-2-chloro-N,N-dimethylbenzamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2ccc(C(=O)N(C)C)c(Cl)c2)cc1 |
| InChI | InChI=1S/C17H18ClN3O4S/c1-11(22)19-12-4-7-14(8-5-12)26(24,25)20-13-6-9-15(16(18)10-13)17(23)21(2)3/h4-10,20H,1-3H3,(H,19,22) |
| InChIKey | MIWDYPHAHZQLRB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.87 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |