C15H15ClN2O3S — CID 7971137
4-[(4-chlorophenyl)sulfamoyl]-N,N-dimethylbenzamide (PubChem CID 7971137) has the molecular formula C15H15ClN2O3S and a molecular weight of 338.82 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)sulfamoyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[(4-chlorophenyl)sulfamoyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 7971137 |
| Molecular Formula | C15H15ClN2O3S |
| Molecular Weight | 338.82 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 4-[(4-chlorophenyl)sulfamoyl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C15H15ClN2O3S/c1-18(2)15(19)11-3-9-14(10-4-11)22(20,21)17-13-7-5-12(16)6-8-13/h3-10,17H,1-2H3 |
| InChIKey | OBEXJSMTSJELLA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.82 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |