C18H20N2O3S — CID 24580864
4-(2,3-dihydro-1H-inden-5-ylsulfonylamino)-N,N-dimethylbenzamide (PubChem CID 24580864) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-inden-5-ylsulfonylamino)-N,N-dimethylbenzamide.
| Compound Name | 4-(2,3-dihydro-1H-inden-5-ylsulfonylamino)-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 24580864 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 4-(2,3-dihydro-1H-inden-5-ylsulfonylamino)-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(NS(=O)(=O)c2ccc3c(c2)CCC3)cc1 |
| InChI | InChI=1S/C18H20N2O3S/c1-20(2)18(21)14-6-9-16(10-7-14)19-24(22,23)17-11-8-13-4-3-5-15(13)12-17/h6-12,19H,3-5H2,1-2H3 |
| InChIKey | FURNNUDUEYMBAI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |