C16H17N3O3S — CID 33488490
[4-(2,3-dihydro-1H-inden-5-ylsulfonylamino)phenyl]urea (PubChem CID 33488490) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is [4-(2,3-dihydro-1H-inden-5-ylsulfonylamino)phenyl]urea.
| Compound Name | [4-(2,3-dihydro-1H-inden-5-ylsulfonylamino)phenyl]urea |
|---|---|
| PubChem CID | 33488490 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | [4-(2,3-dihydro-1H-inden-5-ylsulfonylamino)phenyl]urea |
| SMILES | NC(=O)Nc1ccc(NS(=O)(=O)c2ccc3c(c2)CCC3)cc1 |
| InChI | InChI=1S/C16H17N3O3S/c17-16(20)18-13-5-7-14(8-6-13)19-23(21,22)15-9-4-11-2-1-3-12(11)10-15/h4-10,19H,1-3H2,(H3,17,18,20) |
| InChIKey | BQFFCMLCHJHBHZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |