C15H14FNO3S — CID 64780149
N-(3-fluoro-4-hydroxyphenyl)-2,3-dihydro-1H-indene-5-sulfonamide (PubChem CID 64780149) has the molecular formula C15H14FNO3S and a molecular weight of 307.35 g/mol. Its IUPAC name is N-(3-fluoro-4-hydroxyphenyl)-2,3-dihydro-1H-indene-5-sulfonamide.
| Compound Name | N-(3-fluoro-4-hydroxyphenyl)-2,3-dihydro-1H-indene-5-sulfonamide |
|---|---|
| PubChem CID | 64780149 |
| Molecular Formula | C15H14FNO3S |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | N-(3-fluoro-4-hydroxyphenyl)-2,3-dihydro-1H-indene-5-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(O)c(F)c1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H14FNO3S/c16-14-9-12(5-7-15(14)18)17-21(19,20)13-6-4-10-2-1-3-11(10)8-13/h4-9,17-18H,1-3H2 |
| InChIKey | BFQPBZWMTULKRI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|