C19H13Cl4N3O2S2 — CID 19678641
1-(3,4-dichlorophenyl)-3-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]thiourea (PubChem CID 19678641) has the molecular formula C19H13Cl4N3O2S2 and a molecular weight of 521.28 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]thiourea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]thiourea |
|---|---|
| PubChem CID | 19678641 |
| Molecular Formula | C19H13Cl4N3O2S2 |
| Molecular Weight | 521.28 g/mol |
| Exact Mass | 518.92 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]thiourea |
| SMILES | O=S(=O)(Nc1ccc(Cl)c(Cl)c1)c1ccc(NC(=S)Nc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C19H13Cl4N3O2S2/c20-15-7-3-12(9-17(15)22)25-19(29)24-11-1-5-14(6-2-11)30(27,28)26-13-4-8-16(21)18(23)10-13/h1-10,26H,(H2,24,25,29) |
| InChIKey | XBVJFWXWUIRKPI-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.28 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|