C19H14Cl2N2O6S — CID 45268473
N-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]-3,4,5-trihydroxybenzamide (PubChem CID 45268473) has the molecular formula C19H14Cl2N2O6S and a molecular weight of 469.30 g/mol. Its IUPAC name is N-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]-3,4,5-trihydroxybenzamide.
| Compound Name | N-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]-3,4,5-trihydroxybenzamide |
|---|---|
| PubChem CID | 45268473 |
| Molecular Formula | C19H14Cl2N2O6S |
| Molecular Weight | 469.30 g/mol |
| Exact Mass | 467.99 |
| IUPAC Name | N-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]-3,4,5-trihydroxybenzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2ccc(Cl)c(Cl)c2)cc1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C19H14Cl2N2O6S/c20-14-6-3-12(9-15(14)21)23-30(28,29)13-4-1-11(2-5-13)22-19(27)10-7-16(24)18(26)17(25)8-10/h1-9,23-26H,(H,22,27) |
| InChIKey | BMTZVESLRWPUAI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.30 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|