C26H22ClN3O5S2 — CID 126416723
4-(benzenesulfonamido)-N-[4-[(3-chloro-4-methylphenyl)sulfamoyl]phenyl]benzamide (PubChem CID 126416723) has the molecular formula C26H22ClN3O5S2 and a molecular weight of 556.07 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-N-[4-[(3-chloro-4-methylphenyl)sulfamoyl]phenyl]benzamide.
| Compound Name | 4-(benzenesulfonamido)-N-[4-[(3-chloro-4-methylphenyl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 126416723 |
| Molecular Formula | C26H22ClN3O5S2 |
| Molecular Weight | 556.07 g/mol |
| Exact Mass | 555.07 |
| IUPAC Name | 4-(benzenesulfonamido)-N-[4-[(3-chloro-4-methylphenyl)sulfamoyl]phenyl]benzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(NC(=O)c3ccc(NS(=O)(=O)c4ccccc4)cc3)cc2)cc1Cl |
| InChI | InChI=1S/C26H22ClN3O5S2/c1-18-7-10-22(17-25(18)27)30-37(34,35)24-15-13-20(14-16-24)28-26(31)19-8-11-21(12-9-19)29-36(32,33)23-5-3-2-4-6-23/h2-17,29-30H,1H3,(H,28,31) |
| InChIKey | VQULRHJFVLWWBV-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.07 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |