C20H16ClIN2O3S — CID 3955566
N-[4-[(3-chloro-4-methylphenyl)sulfamoyl]phenyl]-4-iodobenzamide (PubChem CID 3955566) has the molecular formula C20H16ClIN2O3S and a molecular weight of 526.78 g/mol. Its IUPAC name is N-[4-[(3-chloro-4-methylphenyl)sulfamoyl]phenyl]-4-iodobenzamide.
| Compound Name | N-[4-[(3-chloro-4-methylphenyl)sulfamoyl]phenyl]-4-iodobenzamide |
|---|---|
| PubChem CID | 3955566 |
| Molecular Formula | C20H16ClIN2O3S |
| Molecular Weight | 526.78 g/mol |
| Exact Mass | 525.96 |
| IUPAC Name | N-[4-[(3-chloro-4-methylphenyl)sulfamoyl]phenyl]-4-iodobenzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(NC(=O)c3ccc(I)cc3)cc2)cc1Cl |
| InChI | InChI=1S/C20H16ClIN2O3S/c1-13-2-7-17(12-19(13)21)24-28(26,27)18-10-8-16(9-11-18)23-20(25)14-3-5-15(22)6-4-14/h2-12,24H,1H3,(H,23,25) |
| InChIKey | FCMDGHJAKZYLAT-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.78 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|