C28H27N3O5S2 — CID 126415351
3-[(3,4-dimethylphenyl)sulfamoyl]-4-methyl-N-[4-(phenylsulfamoyl)phenyl]benzamide (PubChem CID 126415351) has the molecular formula C28H27N3O5S2 and a molecular weight of 549.67 g/mol. Its IUPAC name is 3-[(3,4-dimethylphenyl)sulfamoyl]-4-methyl-N-[4-(phenylsulfamoyl)phenyl]benzamide.
| Compound Name | 3-[(3,4-dimethylphenyl)sulfamoyl]-4-methyl-N-[4-(phenylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 126415351 |
| Molecular Formula | C28H27N3O5S2 |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.14 |
| IUPAC Name | 3-[(3,4-dimethylphenyl)sulfamoyl]-4-methyl-N-[4-(phenylsulfamoyl)phenyl]benzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cc(C(=O)Nc3ccc(S(=O)(=O)Nc4ccccc4)cc3)ccc2C)cc1C |
| InChI | InChI=1S/C28H27N3O5S2/c1-19-10-12-25(17-21(19)3)31-38(35,36)27-18-22(11-9-20(27)2)28(32)29-23-13-15-26(16-14-23)37(33,34)30-24-7-5-4-6-8-24/h4-18,30-31H,1-3H3,(H,29,32) |
| InChIKey | SEVHIIDFKPOLOR-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |