C19H12Cl3FN2O3S — CID 18892799
3-chloro-N-[4-[(3,4-dichlorophenyl)sulfamoyl]-2-fluorophenyl]benzamide (PubChem CID 18892799) has the molecular formula C19H12Cl3FN2O3S and a molecular weight of 473.74 g/mol. Its IUPAC name is 3-chloro-N-[4-[(3,4-dichlorophenyl)sulfamoyl]-2-fluorophenyl]benzamide.
| Compound Name | 3-chloro-N-[4-[(3,4-dichlorophenyl)sulfamoyl]-2-fluorophenyl]benzamide |
|---|---|
| PubChem CID | 18892799 |
| Molecular Formula | C19H12Cl3FN2O3S |
| Molecular Weight | 473.74 g/mol |
| Exact Mass | 471.96 |
| IUPAC Name | 3-chloro-N-[4-[(3,4-dichlorophenyl)sulfamoyl]-2-fluorophenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2ccc(Cl)c(Cl)c2)cc1F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H12Cl3FN2O3S/c20-12-3-1-2-11(8-12)19(26)24-18-7-5-14(10-17(18)23)29(27,28)25-13-4-6-15(21)16(22)9-13/h1-10,25H,(H,24,26) |
| InChIKey | RESKWUWKIHKVIU-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.74 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |