C20H12Cl2F4N2O3S — CID 18892646
4-chloro-N-[4-[[4-chloro-3-(trifluoromethyl)phenyl]sulfamoyl]-2-fluorophenyl]benzamide (PubChem CID 18892646) has the molecular formula C20H12Cl2F4N2O3S and a molecular weight of 507.29 g/mol. Its IUPAC name is 4-chloro-N-[4-[[4-chloro-3-(trifluoromethyl)phenyl]sulfamoyl]-2-fluorophenyl]benzamide.
| Compound Name | 4-chloro-N-[4-[[4-chloro-3-(trifluoromethyl)phenyl]sulfamoyl]-2-fluorophenyl]benzamide |
|---|---|
| PubChem CID | 18892646 |
| Molecular Formula | C20H12Cl2F4N2O3S |
| Molecular Weight | 507.29 g/mol |
| Exact Mass | 505.99 |
| IUPAC Name | 4-chloro-N-[4-[[4-chloro-3-(trifluoromethyl)phenyl]sulfamoyl]-2-fluorophenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)cc1F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H12Cl2F4N2O3S/c21-12-3-1-11(2-4-12)19(29)27-18-8-6-14(10-17(18)23)32(30,31)28-13-5-7-16(22)15(9-13)20(24,25)26/h1-10,28H,(H,27,29) |
| InChIKey | VTMYIPWGINOJSQ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.29 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |