C20H13F5N2O3S — CID 18893459
4-fluoro-N-[2-fluoro-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]benzamide (PubChem CID 18893459) has the molecular formula C20H13F5N2O3S and a molecular weight of 456.39 g/mol. Its IUPAC name is 4-fluoro-N-[2-fluoro-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]benzamide.
| Compound Name | 4-fluoro-N-[2-fluoro-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 18893459 |
| Molecular Formula | C20H13F5N2O3S |
| Molecular Weight | 456.39 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | 4-fluoro-N-[2-fluoro-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2cccc(C(F)(F)F)c2)cc1F)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H13F5N2O3S/c21-14-6-4-12(5-7-14)19(28)26-18-9-8-16(11-17(18)22)31(29,30)27-15-3-1-2-13(10-15)20(23,24)25/h1-11,27H,(H,26,28) |
| InChIKey | MPWFKSKSNRCQBN-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.39 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |