C14H8F4NO4S- — CID 5203374
2-fluoro-5-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzoate (PubChem CID 5203374) has the molecular formula C14H8F4NO4S- and a molecular weight of 362.28 g/mol. Its IUPAC name is 2-fluoro-5-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzoate.
| Compound Name | 2-fluoro-5-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 5203374 |
| Molecular Formula | C14H8F4NO4S- |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 2-fluoro-5-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzoate |
| SMILES | O=C([O-])c1cc(S(=O)(=O)Nc2cccc(C(F)(F)F)c2)ccc1F |
| InChI | InChI=1S/C14H9F4NO4S/c15-12-5-4-10(7-11(12)13(20)21)24(22,23)19-9-3-1-2-8(6-9)14(16,17)18/h1-7,19H,(H,20,21)/p-1 |
| InChIKey | ABNXSWIGCAMFKY-UHFFFAOYSA-M |
| XLogP | 2.01 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |