C18H16ClF3N2O3S2 — CID 55868940
4-chloro-3-(thiomorpholine-4-carbonyl)-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 55868940) has the molecular formula C18H16ClF3N2O3S2 and a molecular weight of 464.92 g/mol. Its IUPAC name is 4-chloro-3-(thiomorpholine-4-carbonyl)-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | 4-chloro-3-(thiomorpholine-4-carbonyl)-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55868940 |
| Molecular Formula | C18H16ClF3N2O3S2 |
| Molecular Weight | 464.92 g/mol |
| Exact Mass | 464.02 |
| IUPAC Name | 4-chloro-3-(thiomorpholine-4-carbonyl)-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | O=C(c1cc(S(=O)(=O)Nc2cccc(C(F)(F)F)c2)ccc1Cl)N1CCSCC1 |
| InChI | InChI=1S/C18H16ClF3N2O3S2/c19-16-5-4-14(11-15(16)17(25)24-6-8-28-9-7-24)29(26,27)23-13-3-1-2-12(10-13)18(20,21)22/h1-5,10-11,23H,6-9H2 |
| InChIKey | QCVPSELLAOCACY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.92 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |