C18H13ClF3NO6S — CID 2646121
[(3R)-2-oxooxolan-3-yl] 2-chloro-5-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzoate (PubChem CID 2646121) has the molecular formula C18H13ClF3NO6S and a molecular weight of 463.82 g/mol. Its IUPAC name is [(3R)-2-oxooxolan-3-yl] 2-chloro-5-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzoate.
| Compound Name | [(3R)-2-oxooxolan-3-yl] 2-chloro-5-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2646121 |
| Molecular Formula | C18H13ClF3NO6S |
| Molecular Weight | 463.82 g/mol |
| Exact Mass | 463.01 |
| IUPAC Name | [(3R)-2-oxooxolan-3-yl] 2-chloro-5-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzoate |
| SMILES | O=C(O[C@@H]1CCOC1=O)c1cc(S(=O)(=O)Nc2cccc(C(F)(F)F)c2)ccc1Cl |
| InChI | InChI=1S/C18H13ClF3NO6S/c19-14-5-4-12(9-13(14)16(24)29-15-6-7-28-17(15)25)30(26,27)23-11-3-1-2-10(8-11)18(20,21)22/h1-5,8-9,15,23H,6-7H2/t15-/m1/s1 |
| InChIKey | NQCPFBVVSNJMER-OAHLLOKOSA-N |
| XLogP | 3.63 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.82 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |