C17H14ClNO6S — CID 2463256
[(3R)-2-oxooxolan-3-yl] 3-[(3-chlorophenyl)sulfamoyl]benzoate (PubChem CID 2463256) has the molecular formula C17H14ClNO6S and a molecular weight of 395.82 g/mol. Its IUPAC name is [(3R)-2-oxooxolan-3-yl] 3-[(3-chlorophenyl)sulfamoyl]benzoate.
| Compound Name | [(3R)-2-oxooxolan-3-yl] 3-[(3-chlorophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2463256 |
| Molecular Formula | C17H14ClNO6S |
| Molecular Weight | 395.82 g/mol |
| Exact Mass | 395.02 |
| IUPAC Name | [(3R)-2-oxooxolan-3-yl] 3-[(3-chlorophenyl)sulfamoyl]benzoate |
| SMILES | O=C(O[C@@H]1CCOC1=O)c1cccc(S(=O)(=O)Nc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C17H14ClNO6S/c18-12-4-2-5-13(10-12)19-26(22,23)14-6-1-3-11(9-14)16(20)25-15-7-8-24-17(15)21/h1-6,9-10,15,19H,7-8H2/t15-/m1/s1 |
| InChIKey | VHUDDAHVHKMLMJ-OAHLLOKOSA-N |
| XLogP | 2.61 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.82 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |