C16H18ClNO7S — CID 8645553
[(3S)-2-oxooxolan-3-yl] 4-chloro-3-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzoate (PubChem CID 8645553) has the molecular formula C16H18ClNO7S and a molecular weight of 403.84 g/mol. Its IUPAC name is [(3S)-2-oxooxolan-3-yl] 4-chloro-3-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzoate.
| Compound Name | [(3S)-2-oxooxolan-3-yl] 4-chloro-3-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 8645553 |
| Molecular Formula | C16H18ClNO7S |
| Molecular Weight | 403.84 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | [(3S)-2-oxooxolan-3-yl] 4-chloro-3-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzoate |
| SMILES | O=C(O[C@H]1CCOC1=O)c1ccc(Cl)c(S(=O)(=O)NC[C@H]2CCCO2)c1 |
| InChI | InChI=1S/C16H18ClNO7S/c17-12-4-3-10(15(19)25-13-5-7-24-16(13)20)8-14(12)26(21,22)18-9-11-2-1-6-23-11/h3-4,8,11,13,18H,1-2,5-7,9H2/t11-,13+/m1/s1 |
| InChIKey | UCZWSJKKPHSJAT-YPMHNXCESA-N |
| XLogP | 1.27 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.84 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |