C12H13ClNO5S- — CID 2095487
4-chloro-3-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzoate (PubChem CID 2095487) has the molecular formula C12H13ClNO5S- and a molecular weight of 318.76 g/mol. Its IUPAC name is 4-chloro-3-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzoate.
| Compound Name | 4-chloro-3-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 2095487 |
| Molecular Formula | C12H13ClNO5S- |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 4-chloro-3-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzoate |
| SMILES | O=C([O-])c1ccc(Cl)c(S(=O)(=O)NC[C@@H]2CCCO2)c1 |
| InChI | InChI=1S/C12H14ClNO5S/c13-10-4-3-8(12(15)16)6-11(10)20(17,18)14-7-9-2-1-5-19-9/h3-4,6,9,14H,1-2,5,7H2,(H,15,16)/p-1/t9-/m0/s1 |
| InChIKey | IUKNUIPYYGWRKE-VIFPVBQESA-M |
| XLogP | 0.16 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |