C11H12Cl3NO3S — CID 2897340
2,4,5-trichloro-N-(oxolan-2-ylmethyl)benzenesulfonamide (PubChem CID 2897340) has the molecular formula C11H12Cl3NO3S and a molecular weight of 344.65 g/mol. Its IUPAC name is 2,4,5-trichloro-N-(oxolan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 2,4,5-trichloro-N-(oxolan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2897340 |
| Molecular Formula | C11H12Cl3NO3S |
| Molecular Weight | 344.65 g/mol |
| Exact Mass | 342.96 |
| IUPAC Name | 2,4,5-trichloro-N-(oxolan-2-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCCO1)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H12Cl3NO3S/c12-8-4-10(14)11(5-9(8)13)19(16,17)15-6-7-2-1-3-18-7/h4-5,7,15H,1-3,6H2 |
| InChIKey | XIQFFYPANZOUOP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.65 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|