C13H18ClNO5S — CID 2968373
4-chloro-2,5-dimethoxy-N-(oxolan-2-ylmethyl)benzenesulfonamide (PubChem CID 2968373) has the molecular formula C13H18ClNO5S and a molecular weight of 335.81 g/mol. Its IUPAC name is 4-chloro-2,5-dimethoxy-N-(oxolan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-chloro-2,5-dimethoxy-N-(oxolan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2968373 |
| Molecular Formula | C13H18ClNO5S |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 4-chloro-2,5-dimethoxy-N-(oxolan-2-ylmethyl)benzenesulfonamide |
| SMILES | COc1cc(S(=O)(=O)NCC2CCCO2)c(OC)cc1Cl |
| InChI | InChI=1S/C13H18ClNO5S/c1-18-11-7-13(12(19-2)6-10(11)14)21(16,17)15-8-9-4-3-5-20-9/h6-7,9,15H,3-5,8H2,1-2H3 |
| InChIKey | NCYMXTUESXAPEU-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |