C15H22N2O5S — CID 100829062
4-methoxy-N,N-dimethyl-3-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzamide (PubChem CID 100829062) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is 4-methoxy-N,N-dimethyl-3-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzamide.
| Compound Name | 4-methoxy-N,N-dimethyl-3-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 100829062 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 4-methoxy-N,N-dimethyl-3-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzamide |
| SMILES | COc1ccc(C(=O)N(C)C)cc1S(=O)(=O)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C15H22N2O5S/c1-17(2)15(18)11-6-7-13(21-3)14(9-11)23(19,20)16-10-12-5-4-8-22-12/h6-7,9,12,16H,4-5,8,10H2,1-3H3/t12-/m1/s1 |
| InChIKey | PNGTYFRHMLEHKN-GFCCVEGCSA-N |
| XLogP | 0.85 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |