C13H19NO5S — CID 19682484
2,4-dimethoxy-N-(oxolan-2-ylmethyl)benzenesulfonamide (PubChem CID 19682484) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is 2,4-dimethoxy-N-(oxolan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 2,4-dimethoxy-N-(oxolan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 19682484 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2,4-dimethoxy-N-(oxolan-2-ylmethyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCC2CCCO2)c(OC)c1 |
| InChI | InChI=1S/C13H19NO5S/c1-17-10-5-6-13(12(8-10)18-2)20(15,16)14-9-11-4-3-7-19-11/h5-6,8,11,14H,3-4,7,9H2,1-2H3 |
| InChIKey | FJSXFKJBHTZLDW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |