C17H22N4O5S — CID 113039856
2,4-dimethoxy-N-[6-(oxolan-2-ylmethylamino)pyridazin-3-yl]benzenesulfonamide (PubChem CID 113039856) has the molecular formula C17H22N4O5S and a molecular weight of 394.45 g/mol. Its IUPAC name is 2,4-dimethoxy-N-[6-(oxolan-2-ylmethylamino)pyridazin-3-yl]benzenesulfonamide.
| Compound Name | 2,4-dimethoxy-N-[6-(oxolan-2-ylmethylamino)pyridazin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 113039856 |
| Molecular Formula | C17H22N4O5S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 2,4-dimethoxy-N-[6-(oxolan-2-ylmethylamino)pyridazin-3-yl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(NCC3CCCO3)nn2)c(OC)c1 |
| InChI | InChI=1S/C17H22N4O5S/c1-24-12-5-6-15(14(10-12)25-2)27(22,23)21-17-8-7-16(19-20-17)18-11-13-4-3-9-26-13/h5-8,10,13H,3-4,9,11H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | MUHLHGNOSSWLFH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |