C20H24N2O6S — CID 8843784
2-[(2,5-dimethoxyphenyl)sulfonylamino]-N-[[(2R)-oxolan-2-yl]methyl]benzamide (PubChem CID 8843784) has the molecular formula C20H24N2O6S and a molecular weight of 420.49 g/mol. Its IUPAC name is 2-[(2,5-dimethoxyphenyl)sulfonylamino]-N-[[(2R)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 2-[(2,5-dimethoxyphenyl)sulfonylamino]-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 8843784 |
| Molecular Formula | C20H24N2O6S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 2-[(2,5-dimethoxyphenyl)sulfonylamino]-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)Nc2ccccc2C(=O)NC[C@H]2CCCO2)c1 |
| InChI | InChI=1S/C20H24N2O6S/c1-26-14-9-10-18(27-2)19(12-14)29(24,25)22-17-8-4-3-7-16(17)20(23)21-13-15-6-5-11-28-15/h3-4,7-10,12,15,22H,5-6,11,13H2,1-2H3,(H,21,23)/t15-/m1/s1 |
| InChIKey | WSRHXEBHJANFET-OAHLLOKOSA-N |
| XLogP | 2.41 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |