C18H18F2N2O4S — CID 40821094
2-[(2,5-difluorophenyl)sulfonylamino]-N-[[(2R)-oxolan-2-yl]methyl]benzamide (PubChem CID 40821094) has the molecular formula C18H18F2N2O4S and a molecular weight of 396.42 g/mol. Its IUPAC name is 2-[(2,5-difluorophenyl)sulfonylamino]-N-[[(2R)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 2-[(2,5-difluorophenyl)sulfonylamino]-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 40821094 |
| Molecular Formula | C18H18F2N2O4S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 2-[(2,5-difluorophenyl)sulfonylamino]-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
| SMILES | O=C(NC[C@H]1CCCO1)c1ccccc1NS(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C18H18F2N2O4S/c19-12-7-8-15(20)17(10-12)27(24,25)22-16-6-2-1-5-14(16)18(23)21-11-13-4-3-9-26-13/h1-2,5-8,10,13,22H,3-4,9,11H2,(H,21,23)/t13-/m1/s1 |
| InChIKey | LFOIGSXJWNYRMN-CYBMUJFWSA-N |
| XLogP | 2.67 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |